C23H33FNaO5P — CID 18721667
sodium [(E)-6-[2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hex-4-enyl]-methylphosphinate (PubChem CID 18721667) has the molecular formula C23H33FNaO5P and a molecular weight of 462.47 g/mol. Its IUPAC name is sodium [(E)-6-[2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hex-4-enyl]-methylphosphinate.
| Compound Name | sodium [(E)-6-[2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hex-4-enyl]-methylphosphinate |
|---|---|
| PubChem CID | 18721667 |
| Molecular Formula | C23H33FNaO5P |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | sodium [(E)-6-[2-[(E)-5-(2-fluorophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hex-4-enyl]-methylphosphinate |
| SMILES | CP(=O)([O-])CCC/C=C/CC1C(O)CC(O)C1/C=C/C(O)CCc1ccccc1F.[Na+] |
| InChI | InChI=1S/C23H34FO5P.Na/c1-30(28,29)15-7-3-2-4-9-19-20(23(27)16-22(19)26)14-13-18(25)12-11-17-8-5-6-10-21(17)24;/h2,4-6,8,10,13-14,18-20,22-23,25-27H,3,7,9,11-12,15-16H2,1H3,(H,28,29);/q;+1/p-1/b4-2+,14-13+; |
| InChIKey | RNAOBJBLYMLWKU-HURWLIPGSA-M |
| XLogP | 0.03 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|