C15H20O2 — CID 18725699
1-ethynylperoxy-3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalene (PubChem CID 18725699) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-ethynylperoxy-3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalene.
| Compound Name | 1-ethynylperoxy-3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 18725699 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-ethynylperoxy-3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalene |
| SMILES | C#COOC1CC(C)C=C2C=CC(C)C(C)C21 |
| InChI | InChI=1S/C15H20O2/c1-5-16-17-14-9-10(2)8-13-7-6-11(3)12(4)15(13)14/h1,6-8,10-12,14-15H,9H2,2-4H3 |
| InChIKey | UQKGCUBCAOIVRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|