C20H34O2 — CID 144967307
3,3-dimethylpentan-2-one;3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 144967307) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3,3-dimethylpentan-2-one;3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | 3,3-dimethylpentan-2-one;3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 144967307 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3,3-dimethylpentan-2-one;3,7,8-trimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CC1C=C2C=CC(C)C(C)C2C(O)C1.CCC(C)(C)C(C)=O |
| InChI | InChI=1S/C13H20O.C7H14O/c1-8-6-11-5-4-9(2)10(3)13(11)12(14)7-8;1-5-7(3,4)6(2)8/h4-6,8-10,12-14H,7H2,1-3H3;5H2,1-4H3 |
| InChIKey | IUCWXMUWTUVADY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |