C15H22O2 — CID 54376318
5-ethynylperoxy-3,4,7-trimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene (PubChem CID 54376318) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-ethynylperoxy-3,4,7-trimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene.
| Compound Name | 5-ethynylperoxy-3,4,7-trimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
|---|---|
| PubChem CID | 54376318 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-ethynylperoxy-3,4,7-trimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES | C#COOC1CC(C)C=C2CCC(C)C(C)C21 |
| InChI | InChI=1S/C15H22O2/c1-5-16-17-14-9-10(2)8-13-7-6-11(3)12(4)15(13)14/h1,8,10-12,14-15H,6-7,9H2,2-4H3 |
| InChIKey | HPYMPELQHUDXFL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|