C22H30FN5O4S — CID 18727261
(2R)-4-(cyclopropylmethyl)-1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]sulfonyl-N-hydroxypiperazine-2-carboxamide (PubChem CID 18727261) has the molecular formula C22H30FN5O4S and a molecular weight of 479.58 g/mol. Its IUPAC name is (2R)-4-(cyclopropylmethyl)-1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]sulfonyl-N-hydroxypiperazine-2-carboxamide.
| Compound Name | (2R)-4-(cyclopropylmethyl)-1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18727261 |
| Molecular Formula | C22H30FN5O4S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (2R)-4-(cyclopropylmethyl)-1-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]sulfonyl-N-hydroxypiperazine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CN(CC2CC2)CCN1S(=O)(=O)N1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C22H30FN5O4S/c23-17-3-4-20-18(11-17)19(12-24-20)16-5-7-27(8-6-16)33(31,32)28-10-9-26(13-15-1-2-15)14-21(28)22(29)25-30/h3-4,11-12,15-16,21,24,30H,1-2,5-10,13-14H2,(H,25,29)/t21-/m1/s1 |
| InChIKey | AFNJYPCPILRYBJ-OAQYLSRUSA-N |
| XLogP | 1.63 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|