C23H17ClF3N5O3 — CID 18727653
2-[[4-(aziridine-1-carboximidoyl)benzoyl]amino]-N-(5-chloro-2-pyridinyl)-5-(trifluoromethoxy)benzamide (PubChem CID 18727653) has the molecular formula C23H17ClF3N5O3 and a molecular weight of 503.87 g/mol. Its IUPAC name is 2-[[4-(aziridine-1-carboximidoyl)benzoyl]amino]-N-(5-chloro-2-pyridinyl)-5-(trifluoromethoxy)benzamide.
| Compound Name | 2-[[4-(aziridine-1-carboximidoyl)benzoyl]amino]-N-(5-chloro-2-pyridinyl)-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18727653 |
| Molecular Formula | C23H17ClF3N5O3 |
| Molecular Weight | 503.87 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-[[4-(aziridine-1-carboximidoyl)benzoyl]amino]-N-(5-chloro-2-pyridinyl)-5-(trifluoromethoxy)benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OC(F)(F)F)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CC1 |
| InChI | InChI=1S/C23H17ClF3N5O3/c24-15-5-8-19(29-12-15)31-22(34)17-11-16(35-23(25,26)27)6-7-18(17)30-21(33)14-3-1-13(2-4-14)20(28)32-9-10-32/h1-8,11-12,28H,9-10H2,(H,30,33)(H,29,31,34)/b28-20- |
| InChIKey | NGWRPADEYWGSPI-RRAHZORUSA-N |
| XLogP | 4.78 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|