C20H19ClN6O2 — CID 18728008
N-(4-chlorophenyl)-1-methyl-5-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]pyrazole-4-carboxamide (PubChem CID 18728008) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-methyl-5-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]pyrazole-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-methyl-5-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18728008 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(4-chlorophenyl)-1-methyl-5-[[4-(N'-methylcarbamimidoyl)benzoyl]amino]pyrazole-4-carboxamide |
| SMILES | C/N=C(\N)c1ccc(C(=O)Nc2c(C(=O)Nc3ccc(Cl)cc3)cnn2C)cc1 |
| InChI | InChI=1S/C20H19ClN6O2/c1-23-17(22)12-3-5-13(6-4-12)19(28)26-18-16(11-24-27(18)2)20(29)25-15-9-7-14(21)8-10-15/h3-11H,1-2H3,(H2,22,23)(H,25,29)(H,26,28) |
| InChIKey | JUXLZSKBAANKIK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|