C21H22ClN7O4S — CID 18727973
N-(2-aminoperoxysulfanyl-4-chlorophenyl)-5-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-1-methylpyrazole-4-carboxamide (PubChem CID 18727973) has the molecular formula C21H22ClN7O4S and a molecular weight of 503.97 g/mol. Its IUPAC name is N-(2-aminoperoxysulfanyl-4-chlorophenyl)-5-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(2-aminoperoxysulfanyl-4-chlorophenyl)-5-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18727973 |
| Molecular Formula | C21H22ClN7O4S |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | N-(2-aminoperoxysulfanyl-4-chlorophenyl)-5-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-1-methylpyrazole-4-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(C(=O)Nc3ccc(Cl)cc3SOON)cnn2C)cc1)N(C)C |
| InChI | InChI=1S/C21H22ClN7O4S/c1-28(2)18(23)12-4-6-13(7-5-12)20(30)27-19-15(11-25-29(19)3)21(31)26-16-9-8-14(22)10-17(16)34-33-32-24/h4-11,23H,24H2,1-3H3,(H,26,31)(H,27,30)/b23-18- |
| InChIKey | YRLYIWXZQCDNQN-NKFKGCMQSA-N |
| XLogP | 3.29 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|