C10H19NO4 — CID 18728836
4-hydroxy-N-(2-hydroxypropyl)-N,4-dimethyl-3-oxopentanamide (PubChem CID 18728836) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-hydroxy-N-(2-hydroxypropyl)-N,4-dimethyl-3-oxopentanamide.
| Compound Name | 4-hydroxy-N-(2-hydroxypropyl)-N,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 18728836 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-hydroxy-N-(2-hydroxypropyl)-N,4-dimethyl-3-oxopentanamide |
| SMILES | CC(O)CN(C)C(=O)CC(=O)C(C)(C)O |
| InChI | InChI=1S/C10H19NO4/c1-7(12)6-11(4)9(14)5-8(13)10(2,3)15/h7,12,15H,5-6H2,1-4H3 |
| InChIKey | GWKAADIZCMXVMY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|