C17H26N2O3 — CID 18729401
N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2,2-trimethyl-4-(4-methylphenyl)butanamide (PubChem CID 18729401) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2,2-trimethyl-4-(4-methylphenyl)butanamide.
| Compound Name | N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2,2-trimethyl-4-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 18729401 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2,2-trimethyl-4-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(CCC(C)(C)C(=O)N(C)C(C)C(=O)NO)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-6-8-14(9-7-12)10-11-17(3,4)16(21)19(5)13(2)15(20)18-22/h6-9,13,22H,10-11H2,1-5H3,(H,18,20) |
| InChIKey | DDBIPEAAHRLZLM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|