C34H59N3O2S — CID 18730627
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(1-amino-4-sulfanylbutylidene)amino]ethyl]carbamate (PubChem CID 18730627) has the molecular formula C34H59N3O2S and a molecular weight of 573.93 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(1-amino-4-sulfanylbutylidene)amino]ethyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(1-amino-4-sulfanylbutylidene)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 18730627 |
| Molecular Formula | C34H59N3O2S |
| Molecular Weight | 573.93 g/mol |
| Exact Mass | 573.43 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(1-amino-4-sulfanylbutylidene)amino]ethyl]carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCC/N=C(/N)CCCS)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H59N3O2S/c1-23(2)8-6-9-24(3)28-13-14-29-27-12-11-25-22-26(15-17-33(25,4)30(27)16-18-34(28,29)5)39-32(38)37-20-19-36-31(35)10-7-21-40/h11,23-24,26-30,40H,6-10,12-22H2,1-5H3,(H2,35,36)(H,37,38) |
| InChIKey | DBNLTKQJQWOQHU-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.93 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|