C27H43N4O4PS — CID 18731502
5-(dimethylamino)-N-[6-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyhexyl]naphthalene-1-sulfonamide (PubChem CID 18731502) has the molecular formula C27H43N4O4PS and a molecular weight of 550.71 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[6-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyhexyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[6-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyhexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 18731502 |
| Molecular Formula | C27H43N4O4PS |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 5-(dimethylamino)-N-[6-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxyhexyl]naphthalene-1-sulfonamide |
| SMILES | [C-]#[N+]CCOP(OCCCCCCNS(=O)(=O)c1cccc2c(N(C)C)cccc12)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H43N4O4PS/c1-22(2)31(23(3)4)36(35-21-19-28-5)34-20-11-9-8-10-18-29-37(32,33)27-17-13-14-24-25(27)15-12-16-26(24)30(6)7/h12-17,22-23,29H,8-11,18-21H2,1-4,6-7H3 |
| InChIKey | IESGMTNOKSVPDK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|