C24H28ClN3O3 — CID 18733991
N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-N-pentyl-1,3-benzodioxole-5-carboxamide (PubChem CID 18733991) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-N-pentyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-N-pentyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 18733991 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-N-pentyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCCCN(Cc1nc2ccc(Cl)cc2n1CCC)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H28ClN3O3/c1-3-5-6-12-27(24(29)17-7-10-21-22(13-17)31-16-30-21)15-23-26-19-9-8-18(25)14-20(19)28(23)11-4-2/h7-10,13-14H,3-6,11-12,15-16H2,1-2H3 |
| InChIKey | JWTAQMWKTYIPRH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|