C20H26IN3O2 — CID 18739482
(2,4,6-trimethylcyclohexyl) 2-iodo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 18739482) has the molecular formula C20H26IN3O2 and a molecular weight of 467.35 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-iodo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-iodo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 18739482 |
| Molecular Formula | C20H26IN3O2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-iodo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | Cc1ccc(-c2n[nH]c(C(I)C(=O)OC3C(C)CC(C)CC3C)n2)cc1 |
| InChI | InChI=1S/C20H26IN3O2/c1-11-5-7-15(8-6-11)18-22-19(24-23-18)16(21)20(25)26-17-13(3)9-12(2)10-14(17)4/h5-8,12-14,16-17H,9-10H2,1-4H3,(H,22,23,24) |
| InChIKey | UFUHERBIXVATFS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|