C24H29N5O6 — CID 20751841
1-O-methyl 4-O-(2,4,6-trimethylcyclohexyl) 2-cyano-3-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]butanedioate (PubChem CID 20751841) has the molecular formula C24H29N5O6 and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-O-methyl 4-O-(2,4,6-trimethylcyclohexyl) 2-cyano-3-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]butanedioate.
| Compound Name | 1-O-methyl 4-O-(2,4,6-trimethylcyclohexyl) 2-cyano-3-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]butanedioate |
|---|---|
| PubChem CID | 20751841 |
| Molecular Formula | C24H29N5O6 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 1-O-methyl 4-O-(2,4,6-trimethylcyclohexyl) 2-cyano-3-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]butanedioate |
| SMILES | COC(=O)C(C#N)C(C(=O)OC1C(C)CC(C)CC1C)c1nc(-c2ccc(C)c([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C24H29N5O6/c1-12-8-14(3)20(15(4)9-12)35-24(31)19(17(11-25)23(30)34-5)22-26-21(27-28-22)16-7-6-13(2)18(10-16)29(32)33/h6-7,10,12,14-15,17,19-20H,8-9H2,1-5H3,(H,26,27,28) |
| InChIKey | LALUUPCGWZFUKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 161.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|