C15H14KN5O6 — CID 18739569
potassium 3-cyano-2-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]-4-methylperoxybutanoate (PubChem CID 18739569) has the molecular formula C15H14KN5O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is potassium 3-cyano-2-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]-4-methylperoxybutanoate.
| Compound Name | potassium 3-cyano-2-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]-4-methylperoxybutanoate |
|---|---|
| PubChem CID | 18739569 |
| Molecular Formula | C15H14KN5O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | potassium 3-cyano-2-[3-(4-methyl-3-nitrophenyl)-1H-1,2,4-triazol-5-yl]-4-methylperoxybutanoate |
| SMILES | COOCC(C#N)C(C(=O)[O-])c1nc(-c2ccc(C)c([N+](=O)[O-])c2)n[nH]1.[K+] |
| InChI | InChI=1S/C15H15N5O6.K/c1-8-3-4-9(5-11(8)20(23)24)13-17-14(19-18-13)12(15(21)22)10(6-16)7-26-25-2;/h3-5,10,12H,7H2,1-2H3,(H,21,22)(H,17,18,19);/q;+1/p-1 |
| InChIKey | RWJDDGOPAQLWKB-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 167.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|