C32H46BrN3O2 — CID 20751829
[4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl] 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 20751829) has the molecular formula C32H46BrN3O2 and a molecular weight of 584.64 g/mol. Its IUPAC name is [4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl] 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | [4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl] 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 20751829 |
| Molecular Formula | C32H46BrN3O2 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | [4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl] 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | Cc1ccc(-c2n[nH]c(C(Br)C(=O)OC3C(C4(C)CCCCC4)CC(C)CC3C3(C)CCCCC3)n2)cc1 |
| InChI | InChI=1S/C32H46BrN3O2/c1-21-11-13-23(14-12-21)28-34-29(36-35-28)26(33)30(37)38-27-24(31(3)15-7-5-8-16-31)19-22(2)20-25(27)32(4)17-9-6-10-18-32/h11-14,22,24-27H,5-10,15-20H2,1-4H3,(H,34,35,36) |
| InChIKey | BOFLRNUVVXHQIV-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|