C6H8N2 — CID 18740919
4-iminocyclohexa-1,5-dien-1-amine (PubChem CID 18740919) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 4-iminocyclohexa-1,5-dien-1-amine.
| Compound Name | 4-iminocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 18740919 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 4-iminocyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C1/C=CC(N)=CC1 |
| InChI | InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-3,8H,4,7H2/b8-6- |
| InChIKey | JDINFGYCAGINSG-VURMDHGXSA-N |
| XLogP | 0.81 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|