About 4-iminocyclohexa-1,5-dien-1-amine
4-iminocyclohexa-1,5-dien-1-amine (PubChem CID 18740919) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 4-iminocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-iminocyclohexa-1,5-dien-1-amine |
| PubChem CID | 18740919 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 4-iminocyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C1/C=CC(N)=CC1 |
| InChI | InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-3,8H,4,7H2/b8-6- |
| InChIKey | JDINFGYCAGINSG-VURMDHGXSA-N |
| XLogP | 0.81 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminocyclohexa-1,5-dien-1-amine?
The IUPAC name of 4-iminocyclohexa-1,5-dien-1-amine (CID 18740919) is 4-iminocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 4-iminocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 4-iminocyclohexa-1,5-dien-1-amine is [H]/N=C1/C=CC(N)=CC1.
What is the InChIKey of 4-iminocyclohexa-1,5-dien-1-amine?
The InChIKey is JDINFGYCAGINSG-VURMDHGXSA-N. The full InChI is InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-3,8H,4,7H2/b8-6-.
What are the key properties of 4-iminocyclohexa-1,5-dien-1-amine?
4-iminocyclohexa-1,5-dien-1-amine has a molecular weight of 108.14 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 18740919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).