C11H10F3NO4 — CID 18757543
(E)-4-[2-nitro-4-(trifluoromethyl)phenyl]but-3-ene-1,2-diol (PubChem CID 18757543) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (E)-4-[2-nitro-4-(trifluoromethyl)phenyl]but-3-ene-1,2-diol.
| Compound Name | (E)-4-[2-nitro-4-(trifluoromethyl)phenyl]but-3-ene-1,2-diol |
|---|---|
| PubChem CID | 18757543 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (E)-4-[2-nitro-4-(trifluoromethyl)phenyl]but-3-ene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1/C=C/C(O)CO |
| InChI | InChI=1S/C11H10F3NO4/c12-11(13,14)8-3-1-7(2-4-9(17)6-16)10(5-8)15(18)19/h1-5,9,16-17H,6H2/b4-2+ |
| InChIKey | OBALXRICACMMGD-DUXPYHPUSA-N |
| XLogP | 1.98 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|