C15H16N2O3S2 — CID 18759539
2,4-dimethyl-[1,3]thiazolo[4,5-b]pyridin-4-ium;4-methylbenzenesulfonate (PubChem CID 18759539) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2,4-dimethyl-[1,3]thiazolo[4,5-b]pyridin-4-ium;4-methylbenzenesulfonate.
| Compound Name | 2,4-dimethyl-[1,3]thiazolo[4,5-b]pyridin-4-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18759539 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2,4-dimethyl-[1,3]thiazolo[4,5-b]pyridin-4-ium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1nc2c(ccc[n+]2C)s1 |
| InChI | InChI=1S/C8H9N2S.C7H8O3S/c1-6-9-8-7(11-6)4-3-5-10(8)2;1-6-2-4-7(5-3-6)11(8,9)10/h3-5H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | MOWYTQRHMIHLDW-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|