C14H18ClNO4S — CID 18759884
2'-(4-chlorobutyl)spiro[1,3-dioxolane-2,4'-3H-1λ6,2-benzothiazine] 1',1'-dioxide (PubChem CID 18759884) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is 2'-(4-chlorobutyl)spiro[1,3-dioxolane-2,4'-3H-1λ6,2-benzothiazine] 1',1'-dioxide.
| Compound Name | 2'-(4-chlorobutyl)spiro[1,3-dioxolane-2,4'-3H-1λ6,2-benzothiazine] 1',1'-dioxide |
|---|---|
| PubChem CID | 18759884 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2'-(4-chlorobutyl)spiro[1,3-dioxolane-2,4'-3H-1λ6,2-benzothiazine] 1',1'-dioxide |
| SMILES | O=S1(=O)c2ccccc2C2(CN1CCCCCl)OCCO2 |
| InChI | InChI=1S/C14H18ClNO4S/c15-7-3-4-8-16-11-14(19-9-10-20-14)12-5-1-2-6-13(12)21(16,17)18/h1-2,5-6H,3-4,7-11H2 |
| InChIKey | WPQMTODFGYQRJX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|