C13H27O3Si — CID 18764385
CID 18764385 (PubChem CID 18764385) has the molecular formula C13H27O3Si and a molecular weight of 259.44 g/mol.
| Compound Name | CID 18764385 |
|---|---|
| PubChem CID | 18764385 |
| Molecular Formula | C13H27O3Si |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC([Si])(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C13H27O3Si/c1-10(2,3)14-13(17,15-11(4,5)6)16-12(7,8)9/h1-9H3 |
| InChIKey | OYJDBDFCAMZSFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|