C21H32O6 — CID 18766938
3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 18766938) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 18766938 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-ethyl-3,9-bis(7-oxabicyclo[4.1.0]heptan-3-yl)-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | CCC1(C2CCC3OC3C2)COC2(OCC(C3CCC4OC4C3)CO2)OC1 |
| InChI | InChI=1S/C21H32O6/c1-2-20(15-4-6-17-19(8-15)27-17)11-24-21(25-12-20)22-9-14(10-23-21)13-3-5-16-18(7-13)26-16/h13-19H,2-12H2,1H3 |
| InChIKey | LXWQQEIZWGSIPJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|