C14H17N3O5S — CID 18772364
(E)-N-(1H-pyrazol-5-yl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide (PubChem CID 18772364) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is (E)-N-(1H-pyrazol-5-yl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide.
| Compound Name | (E)-N-(1H-pyrazol-5-yl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 18772364 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (E)-N-(1H-pyrazol-5-yl)-2-(2,4,6-trimethoxyphenyl)ethenesulfonamide |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Nc2ccn[nH]2)c(OC)c1 |
| InChI | InChI=1S/C14H17N3O5S/c1-20-10-8-12(21-2)11(13(9-10)22-3)5-7-23(18,19)17-14-4-6-15-16-14/h4-9H,1-3H3,(H2,15,16,17)/b7-5+ |
| InChIKey | ZRIFXTJAVUJWTB-FNORWQNLSA-N |
| XLogP | 1.85 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |