C15H13FN2 — CID 18785936
3-(3-fluorophenyl)-3,4-dihydroisoquinolin-1-amine (PubChem CID 18785936) has the molecular formula C15H13FN2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-3,4-dihydroisoquinolin-1-amine.
| Compound Name | 3-(3-fluorophenyl)-3,4-dihydroisoquinolin-1-amine |
|---|---|
| PubChem CID | 18785936 |
| Molecular Formula | C15H13FN2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-(3-fluorophenyl)-3,4-dihydroisoquinolin-1-amine |
| SMILES | NC1=NC(c2cccc(F)c2)Cc2ccccc21 |
| InChI | InChI=1S/C15H13FN2/c16-12-6-3-5-11(8-12)14-9-10-4-1-2-7-13(10)15(17)18-14/h1-8,14H,9H2,(H2,17,18) |
| InChIKey | KLWZVSPGLUAFIN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |