C12H14N4O2S — CID 18788283
2-(5-imidazol-1-ylpentanoyl)-1,3-thiazole-4-carboxamide (PubChem CID 18788283) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-(5-imidazol-1-ylpentanoyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(5-imidazol-1-ylpentanoyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 18788283 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-(5-imidazol-1-ylpentanoyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(C(=O)CCCCn2ccnc2)n1 |
| InChI | InChI=1S/C12H14N4O2S/c13-11(18)9-7-19-12(15-9)10(17)3-1-2-5-16-6-4-14-8-16/h4,6-8H,1-3,5H2,(H2,13,18) |
| InChIKey | ZPJLSWVBVARLEL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|