C17H16FN3O2 — CID 58128796
1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-imidazol-1-ylpentan-1-one (PubChem CID 58128796) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-imidazol-1-ylpentan-1-one.
| Compound Name | 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-imidazol-1-ylpentan-1-one |
|---|---|
| PubChem CID | 58128796 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-imidazol-1-ylpentan-1-one |
| SMILES | O=C(CCCCn1ccnc1)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C17H16FN3O2/c18-14-6-4-13(5-7-14)17-11-15(20-23-17)16(22)3-1-2-9-21-10-8-19-12-21/h4-8,10-12H,1-3,9H2 |
| InChIKey | XXSKLZGRPGZMAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|