C25H19NO2S — CID 18790572
1-(9H-fluoren-2-yl)-2-(7-methoxyquinolin-4-yl)sulfanylethanone (PubChem CID 18790572) has the molecular formula C25H19NO2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-(9H-fluoren-2-yl)-2-(7-methoxyquinolin-4-yl)sulfanylethanone.
| Compound Name | 1-(9H-fluoren-2-yl)-2-(7-methoxyquinolin-4-yl)sulfanylethanone |
|---|---|
| PubChem CID | 18790572 |
| Molecular Formula | C25H19NO2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-(9H-fluoren-2-yl)-2-(7-methoxyquinolin-4-yl)sulfanylethanone |
| SMILES | COc1ccc2c(SCC(=O)c3ccc4c(c3)Cc3ccccc3-4)ccnc2c1 |
| InChI | InChI=1S/C25H19NO2S/c1-28-19-7-9-22-23(14-19)26-11-10-25(22)29-15-24(27)17-6-8-21-18(13-17)12-16-4-2-3-5-20(16)21/h2-11,13-14H,12,15H2,1H3 |
| InChIKey | PQTSEQFEUAEWCU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |