C45H56N4O6S — CID 18791248
3-methoxy-4-[[2-[3-[(4-methoxyphenyl)methoxy]propyl]benzenecarbothioyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide (PubChem CID 18791248) has the molecular formula C45H56N4O6S and a molecular weight of 781.03 g/mol. Its IUPAC name is 3-methoxy-4-[[2-[3-[(4-methoxyphenyl)methoxy]propyl]benzenecarbothioyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide.
| Compound Name | 3-methoxy-4-[[2-[3-[(4-methoxyphenyl)methoxy]propyl]benzenecarbothioyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 18791248 |
| Molecular Formula | C45H56N4O6S |
| Molecular Weight | 781.03 g/mol |
| Exact Mass | 780.39 |
| IUPAC Name | 3-methoxy-4-[[2-[3-[(4-methoxyphenyl)methoxy]propyl]benzenecarbothioyl]amino]-N-methyl-N-[4-methyl-2-[6-(4-methylpiperazin-1-yl)-6-oxohexoxy]phenyl]benzamide |
| SMILES | COc1ccc(COCCCc2ccccc2C(=S)Nc2ccc(C(=O)N(C)c3ccc(C)cc3OCCCCCC(=O)N3CCN(C)CC3)cc2OC)cc1 |
| InChI | InChI=1S/C45H56N4O6S/c1-33-16-23-40(42(30-33)55-29-10-6-7-15-43(50)49-26-24-47(2)25-27-49)48(3)45(51)36-19-22-39(41(31-36)53-5)46-44(56)38-14-9-8-12-35(38)13-11-28-54-32-34-17-20-37(52-4)21-18-34/h8-9,12,14,16-23,30-31H,6-7,10-11,13,15,24-29,32H2,1-5H3,(H,46,56) |
| InChIKey | QCIYXHZDGNVITR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.03 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|