C40H38O2Si — CID 18792409
1-tert-butyl-2,5-bis(3-methoxyphenyl)-1,3,4-triphenylsilole (PubChem CID 18792409) has the molecular formula C40H38O2Si and a molecular weight of 578.83 g/mol. Its IUPAC name is 1-tert-butyl-2,5-bis(3-methoxyphenyl)-1,3,4-triphenylsilole.
| Compound Name | 1-tert-butyl-2,5-bis(3-methoxyphenyl)-1,3,4-triphenylsilole |
|---|---|
| PubChem CID | 18792409 |
| Molecular Formula | C40H38O2Si |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 1-tert-butyl-2,5-bis(3-methoxyphenyl)-1,3,4-triphenylsilole |
| SMILES | COc1cccc(C2=C(c3ccccc3)C(c3ccccc3)=C(c3cccc(OC)c3)[Si]2(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C40H38O2Si/c1-40(2,3)43(35-25-13-8-14-26-35)38(31-21-15-23-33(27-31)41-4)36(29-17-9-6-10-18-29)37(30-19-11-7-12-20-30)39(43)32-22-16-24-34(28-32)42-5/h6-28H,1-5H3 |
| InChIKey | KEPWUCRNOWNWCP-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|