C11H14N4S — CID 18792799
5-piperazin-1-yl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 18792799) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-piperazin-1-yl-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-piperazin-1-yl-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 18792799 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-piperazin-1-yl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2ccc(N3CCNCC3)cc2[nH]1 |
| InChI | InChI=1S/C11H14N4S/c16-11-13-9-2-1-8(7-10(9)14-11)15-5-3-12-4-6-15/h1-2,7,12H,3-6H2,(H2,13,14,16) |
| InChIKey | RRJDWIQNBKPAJN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|