About 2-(acetyldiazenyl)acetic acid
2-(acetyldiazenyl)acetic acid (PubChem CID 18793687) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-(acetyldiazenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(acetyldiazenyl)acetic acid |
| PubChem CID | 18793687 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 2-(acetyldiazenyl)acetic acid |
| SMILES | CC(=O)/N=N/CC(=O)O |
| InChI | InChI=1S/C4H6N2O3/c1-3(7)6-5-2-4(8)9/h2H2,1H3,(H,8,9)/b6-5+ |
| InChIKey | HTJJVCKBQHZYKC-AATRIKPKSA-N |
| XLogP | 0.07 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(acetyldiazenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(acetyldiazenyl)acetic acid?
The IUPAC name of 2-(acetyldiazenyl)acetic acid (CID 18793687) is 2-(acetyldiazenyl)acetic acid.
What is the SMILES notation for 2-(acetyldiazenyl)acetic acid?
The canonical SMILES for 2-(acetyldiazenyl)acetic acid is CC(=O)/N=N/CC(=O)O.
What is the InChIKey of 2-(acetyldiazenyl)acetic acid?
The InChIKey is HTJJVCKBQHZYKC-AATRIKPKSA-N. The full InChI is InChI=1S/C4H6N2O3/c1-3(7)6-5-2-4(8)9/h2H2,1H3,(H,8,9)/b6-5+.
What are the key properties of 2-(acetyldiazenyl)acetic acid?
2-(acetyldiazenyl)acetic acid has a molecular weight of 130.10 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(acetyldiazenyl)acetic acid is sourced from PubChem (CID 18793687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).