About 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol
2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 18798766) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol.
Molecular Properties
| Compound Name | 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol |
| PubChem CID | 18798766 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | Cc1oc(-c2cc(N)ccc2N(CCO)CCO)c(C)c1N |
| InChI | InChI=1S/C16H23N3O3/c1-10-15(18)11(2)22-16(10)13-9-12(17)3-4-14(13)19(5-7-20)6-8-21/h3-4,9,20-21H,5-8,17-18H2,1-2H3 |
| InChIKey | UFQPFMYYKPUXQW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol?
The IUPAC name of 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol (CID 18798766) is 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol.
What is the SMILES notation for 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol?
The canonical SMILES for 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol is Cc1oc(-c2cc(N)ccc2N(CCO)CCO)c(C)c1N.
What is the InChIKey of 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol?
The InChIKey is UFQPFMYYKPUXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-10-15(18)11(2)22-16(10)13-9-12(17)3-4-14(13)19(5-7-20)6-8-21/h3-4,9,20-21H,5-8,17-18H2,1-2H3.
What are the key properties of 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol?
2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol has a molecular weight of 305.38 g/mol, XLogP of 1.52, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-2-(4-amino-3,5-dimethylfuran-2-yl)-N-(2-hydroxyethyl)anilino]ethanol is sourced from PubChem (CID 18798766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).