C15H21N3O2S — CID 23286932
2-[4-amino-2-[4-(aminomethyl)thiophen-3-yl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 23286932) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[4-amino-2-[4-(aminomethyl)thiophen-3-yl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-amino-2-[4-(aminomethyl)thiophen-3-yl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 23286932 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[4-amino-2-[4-(aminomethyl)thiophen-3-yl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | NCc1cscc1-c1cc(N)ccc1N(CCO)CCO |
| InChI | InChI=1S/C15H21N3O2S/c16-8-11-9-21-10-14(11)13-7-12(17)1-2-15(13)18(3-5-19)4-6-20/h1-2,7,9-10,19-20H,3-6,8,16-17H2 |
| InChIKey | MLRINKFKCWXWKF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|