C22H25N5O3 — CID 18799534
N-[1-(3,4-dimethoxyphenyl)pyrazol-3-yl]-4-phenylpiperazine-1-carboxamide (PubChem CID 18799534) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)pyrazol-3-yl]-4-phenylpiperazine-1-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)pyrazol-3-yl]-4-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 18799534 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)pyrazol-3-yl]-4-phenylpiperazine-1-carboxamide |
| SMILES | COc1ccc(-n2ccc(NC(=O)N3CCN(c4ccccc4)CC3)n2)cc1OC |
| InChI | InChI=1S/C22H25N5O3/c1-29-19-9-8-18(16-20(19)30-2)27-11-10-21(24-27)23-22(28)26-14-12-25(13-15-26)17-6-4-3-5-7-17/h3-11,16H,12-15H2,1-2H3,(H,23,24,28) |
| InChIKey | KTDVZAWQOCUWCH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |