C36H34N6O4S3 — CID 18806573
(5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18806573) has the molecular formula C36H34N6O4S3 and a molecular weight of 710.91 g/mol. Its IUPAC name is (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18806573 |
| Molecular Formula | C36H34N6O4S3 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(N2C(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CCC(C)CC4)c3)SC2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C36H34N6O4S3/c1-24-17-19-39(20-18-24)49(45,46)30-16-10-11-26(21-30)32-27(23-40(37-32)28-12-6-4-7-13-28)22-31-34(43)41(36(47)48-31)33-25(2)38(3)42(35(33)44)29-14-8-5-9-15-29/h4-16,21-24H,17-20H2,1-3H3/b31-22- |
| InChIKey | JKRDYVVLXBVMFT-VAMRJTSQSA-N |
| XLogP | 6.16 |
| TPSA | 102.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|