C24H24N4O4S3 — CID 18831068
6-(benzylamino)-5-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831068) has the molecular formula C24H24N4O4S3 and a molecular weight of 528.68 g/mol. Its IUPAC name is 6-(benzylamino)-5-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(benzylamino)-5-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831068 |
| Molecular Formula | C24H24N4O4S3 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 6-(benzylamino)-5-[(E)-[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(NCc2ccccc2)c(/C=C2/SC(=S)N(C3CCS(=O)(=O)C3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C24H24N4O4S3/c1-3-27-21(26-13-16-7-5-4-6-8-16)18(15(2)19(12-25)22(27)29)11-20-23(30)28(24(33)34-20)17-9-10-35(31,32)14-17/h4-8,11,17,26H,3,9-10,13-14H2,1-2H3/b20-11+ |
| InChIKey | XZOXYCOPBICWLV-RGVLZGJSSA-N |
| XLogP | 3.05 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|