C15H15N3O4S3 — CID 18832108
3'-methyl-N-(5-nitro-1,3-thiazol-2-yl)spiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide (PubChem CID 18832108) has the molecular formula C15H15N3O4S3 and a molecular weight of 397.50 g/mol. Its IUPAC name is 3'-methyl-N-(5-nitro-1,3-thiazol-2-yl)spiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide.
| Compound Name | 3'-methyl-N-(5-nitro-1,3-thiazol-2-yl)spiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
|---|---|
| PubChem CID | 18832108 |
| Molecular Formula | C15H15N3O4S3 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 3'-methyl-N-(5-nitro-1,3-thiazol-2-yl)spiro[1,3-dithiolane-2,4'-6,7-dihydro-5H-1-benzofuran]-2'-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ncc([N+](=O)[O-])s2)oc2c1C1(CCC2)SCCS1 |
| InChI | InChI=1S/C15H15N3O4S3/c1-8-11-9(3-2-4-15(11)23-5-6-24-15)22-12(8)13(19)17-14-16-7-10(25-14)18(20)21/h7H,2-6H2,1H3,(H,16,17,19) |
| InChIKey | JEDDDCSTXNIHAR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|