C19H21ClN2O3 — CID 18835188
(4Z)-N-(2-chlorophenyl)-4-hydroxyimino-N,3,6,6-tetramethyl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835188) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is (4Z)-N-(2-chlorophenyl)-4-hydroxyimino-N,3,6,6-tetramethyl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-N-(2-chlorophenyl)-4-hydroxyimino-N,3,6,6-tetramethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835188 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4Z)-N-(2-chlorophenyl)-4-hydroxyimino-N,3,6,6-tetramethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)c2ccccc2Cl)oc2c1/C(=N\O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H21ClN2O3/c1-11-16-13(21-24)9-19(2,3)10-15(16)25-17(11)18(23)22(4)14-8-6-5-7-12(14)20/h5-8,24H,9-10H2,1-4H3/b21-13- |
| InChIKey | NBXUDSJPXOIDBB-BKUYFWCQSA-N |
| XLogP | 4.67 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|