C14H12N4OS — CID 18842175
(5E)-3-methyl-2-pyridin-3-ylimino-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 18842175) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is (5E)-3-methyl-2-pyridin-3-ylimino-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-methyl-2-pyridin-3-ylimino-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842175 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (5E)-3-methyl-2-pyridin-3-ylimino-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccc[nH]2)S/C1=N/c1cccnc1 |
| InChI | InChI=1S/C14H12N4OS/c1-18-13(19)12(8-10-4-3-7-16-10)20-14(18)17-11-5-2-6-15-9-11/h2-9,16H,1H3/b12-8+,17-14+ |
| InChIKey | PHSXTTSLASQDQQ-WHVZTFIZSA-N |
| XLogP | 2.64 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|