C15H13N3O2S2 — CID 18844281
(2E,5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844281) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2E,5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844281 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (2E,5Z)-5-[1-(4-hydroxyphenyl)ethylidene]-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | C/C(=C1/S/C(=N/c2nccs2)N(C)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13N3O2S2/c1-9(10-3-5-11(19)6-4-10)12-13(20)18(2)15(22-12)17-14-16-7-8-21-14/h3-8,19H,1-2H3/b12-9-,17-15+ |
| InChIKey | YSYWPWUBYPUVDH-AWGMXQMZSA-N |
| XLogP | 3.47 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|