C24H20FNO3 — CID 18860713
N-benzyl-2-(5-fluoro-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 18860713) has the molecular formula C24H20FNO3 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-benzyl-2-(5-fluoro-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-benzyl-2-(5-fluoro-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18860713 |
| Molecular Formula | C24H20FNO3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-benzyl-2-(5-fluoro-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)Cc2coc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C24H20FNO3/c1-28-21-10-8-20(9-11-21)26(15-17-5-3-2-4-6-17)24(27)13-18-16-29-23-12-7-19(25)14-22(18)23/h2-12,14,16H,13,15H2,1H3 |
| InChIKey | WDXRRARBHMVDEN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |