C26H25NO3 — CID 18861230
N-benzyl-2-(5-ethyl-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 18861230) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-benzyl-2-(5-ethyl-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-benzyl-2-(5-ethyl-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18861230 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-benzyl-2-(5-ethyl-1-benzofuran-3-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | CCc1ccc2occ(CC(=O)N(Cc3ccccc3)c3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C26H25NO3/c1-3-19-9-14-25-24(15-19)21(18-30-25)16-26(28)27(17-20-7-5-4-6-8-20)22-10-12-23(29-2)13-11-22/h4-15,18H,3,16-17H2,1-2H3 |
| InChIKey | PWKMFVAWSUFJII-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |