C26H28N2O3 — CID 18861229
N-[[4-(dimethylamino)phenyl]methyl]-2-(5-ethyl-1-benzofuran-3-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 18861229) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(5-ethyl-1-benzofuran-3-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(5-ethyl-1-benzofuran-3-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18861229 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(5-ethyl-1-benzofuran-3-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCc1ccc2occ(CC(=O)N(Cc3ccc(N(C)C)cc3)Cc3ccco3)c2c1 |
| InChI | InChI=1S/C26H28N2O3/c1-4-19-9-12-25-24(14-19)21(18-31-25)15-26(29)28(17-23-6-5-13-30-23)16-20-7-10-22(11-8-20)27(2)3/h5-14,18H,4,15-17H2,1-3H3 |
| InChIKey | YDBHFMOQCQZSMA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|