C25H22ClNO3 — CID 18861012
N-benzyl-2-(5-chloro-1-benzofuran-3-yl)-N-(4-ethoxyphenyl)acetamide (PubChem CID 18861012) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-benzyl-2-(5-chloro-1-benzofuran-3-yl)-N-(4-ethoxyphenyl)acetamide.
| Compound Name | N-benzyl-2-(5-chloro-1-benzofuran-3-yl)-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18861012 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-benzyl-2-(5-chloro-1-benzofuran-3-yl)-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(Cc2ccccc2)C(=O)Cc2coc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C25H22ClNO3/c1-2-29-22-11-9-21(10-12-22)27(16-18-6-4-3-5-7-18)25(28)14-19-17-30-24-13-8-20(26)15-23(19)24/h3-13,15,17H,2,14,16H2,1H3 |
| InChIKey | FCHIGZDMZCXRLD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |