C20H24BrF2NO4 — CID 18884550
1-[benzyl(2-hydroxyethyl)amino]-3-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]propan-2-ol (PubChem CID 18884550) has the molecular formula C20H24BrF2NO4 and a molecular weight of 460.32 g/mol. Its IUPAC name is 1-[benzyl(2-hydroxyethyl)amino]-3-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]propan-2-ol.
| Compound Name | 1-[benzyl(2-hydroxyethyl)amino]-3-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 18884550 |
| Molecular Formula | C20H24BrF2NO4 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-[benzyl(2-hydroxyethyl)amino]-3-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]propan-2-ol |
| SMILES | OCCN(Cc1ccccc1)CC(O)COCCOc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C20H24BrF2NO4/c21-16-10-18(22)20(19(23)11-16)28-9-8-27-14-17(26)13-24(6-7-25)12-15-4-2-1-3-5-15/h1-5,10-11,17,25-26H,6-9,12-14H2 |
| InChIKey | FXVUCOPXPRCLAL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|