C22H26BrClF2N2O3 — CID 18884559
1-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 18884559) has the molecular formula C22H26BrClF2N2O3 and a molecular weight of 519.81 g/mol. Its IUPAC name is 1-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 18884559 |
| Molecular Formula | C22H26BrClF2N2O3 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 1-[2-(4-bromo-2,6-difluorophenoxy)ethoxy]-3-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CC(O)COCCOc2c(F)cc(Br)cc2F)CC1 |
| InChI | InChI=1S/C22H26BrClF2N2O3/c1-15-2-3-17(24)12-21(15)28-6-4-27(5-7-28)13-18(29)14-30-8-9-31-22-19(25)10-16(23)11-20(22)26/h2-3,10-12,18,29H,4-9,13-14H2,1H3 |
| InChIKey | GBQYBTONTSHZRU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|