C27H35NO4 — CID 18889796
5'-butyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 18889796) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is 5'-butyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 5'-butyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889796 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5'-butyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | CCCCc1ccc2c(c1)C1(OCCO1)C(=O)N2CCCOc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C27H35NO4/c1-5-6-8-21-10-12-24-23(18-21)27(31-15-16-32-27)26(29)28(24)13-7-14-30-25-17-20(4)9-11-22(25)19(2)3/h9-12,17-19H,5-8,13-16H2,1-4H3 |
| InChIKey | VMIGGEKFCFSEHR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|