C26H33NO4 — CID 9177564
5',7'-dimethyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177564) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 5',7'-dimethyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 5',7'-dimethyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177564 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 5',7'-dimethyl-1'-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | Cc1ccc(C(C)C)c(OCCCN2C(=O)C3(OCCCO3)c3cc(C)cc(C)c32)c1 |
| InChI | InChI=1S/C26H33NO4/c1-17(2)21-9-8-18(3)16-23(21)29-11-6-10-27-24-20(5)14-19(4)15-22(24)26(25(27)28)30-12-7-13-31-26/h8-9,14-17H,6-7,10-13H2,1-5H3 |
| InChIKey | OWWWGVWBJILIGH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|