C21H22N2O4S — CID 18896714
(E)-4-[3-[1-(2,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18896714) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is (E)-4-[3-[1-(2,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[1-(2,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18896714 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (E)-4-[3-[1-(2,5-dimethylanilino)-1-oxopropan-2-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc(C)c(NC(=O)C(C)Sc2cccc(NC(=O)/C=C/C(=O)O)c2)c1 |
| InChI | InChI=1S/C21H22N2O4S/c1-13-7-8-14(2)18(11-13)23-21(27)15(3)28-17-6-4-5-16(12-17)22-19(24)9-10-20(25)26/h4-12,15H,1-3H3,(H,22,24)(H,23,27)(H,25,26)/b10-9+ |
| InChIKey | ORZNGFSQWVFPRI-MDZDMXLPSA-N |
| XLogP | 4.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|